About 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline
5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline (PubChem CID 10335054) has the molecular formula C14H20ClNS2
and a molecular weight of 301.91 g/mol. Its IUPAC name is 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline.
Molecular Properties
| Compound Name | 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline |
| PubChem CID | 10335054 |
| Molecular Formula | C14H20ClNS2 |
| Molecular Weight | 301.91 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline |
| SMILES | CCCCC1(c2ccc(Cl)c(N)c2)SCCCS1 |
| InChI | InChI=1S/C14H20ClNS2/c1-2-3-7-14(17-8-4-9-18-14)11-5-6-12(15)13(16)10-11/h5-6,10H,2-4,7-9,16H2,1H3 |
| InChIKey | INQZYYZAARIGFB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.91 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline?
The IUPAC name of 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline (CID 10335054) is 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline.
What is the SMILES notation for 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline?
The canonical SMILES for 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline is CCCCC1(c2ccc(Cl)c(N)c2)SCCCS1.
What is the InChIKey of 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline?
The InChIKey is INQZYYZAARIGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNS2/c1-2-3-7-14(17-8-4-9-18-14)11-5-6-12(15)13(16)10-11/h5-6,10H,2-4,7-9,16H2,1H3.
What are the key properties of 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline?
5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline has a molecular weight of 301.91 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-butyl-1,3-dithian-2-yl)-2-chloroaniline is sourced from PubChem (CID 10335054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).