About 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one
2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one (PubChem CID 10335056) has the molecular formula C15H12BrNO
and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one |
| PubChem CID | 10335056 |
| Molecular Formula | C15H12BrNO |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one |
| SMILES | O=C1CC(c2ccc(Br)cc2)Nc2ccccc21 |
| InChI | InChI=1S/C15H12BrNO/c16-11-7-5-10(6-8-11)14-9-15(18)12-3-1-2-4-13(12)17-14/h1-8,14,17H,9H2 |
| InChIKey | MVBJVBQIUSGFKC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one?
The IUPAC name of 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one (CID 10335056) is 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one.
What is the SMILES notation for 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one?
The canonical SMILES for 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one is O=C1CC(c2ccc(Br)cc2)Nc2ccccc21.
What is the InChIKey of 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one?
The InChIKey is MVBJVBQIUSGFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrNO/c16-11-7-5-10(6-8-11)14-9-15(18)12-3-1-2-4-13(12)17-14/h1-8,14,17H,9H2.
What are the key properties of 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one?
2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one has a molecular weight of 302.17 g/mol, XLogP of 4.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-2,3-dihydro-1H-quinolin-4-one is sourced from PubChem (CID 10335056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).