C12H15BrN2O2 — CID 103351054
N-[(3-bromo-5-nitrophenyl)methyl]-1-(2-methylcyclopropyl)methanamine (PubChem CID 103351054) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is N-[(3-bromo-5-nitrophenyl)methyl]-1-(2-methylcyclopropyl)methanamine.
| Compound Name | N-[(3-bromo-5-nitrophenyl)methyl]-1-(2-methylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 103351054 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-[(3-bromo-5-nitrophenyl)methyl]-1-(2-methylcyclopropyl)methanamine |
| SMILES | CC1CC1CNCc1cc(Br)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15BrN2O2/c1-8-2-10(8)7-14-6-9-3-11(13)5-12(4-9)15(16)17/h3-5,8,10,14H,2,6-7H2,1H3 |
| InChIKey | OBRXIQKUVQXMFO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|