C13H21F5O2 — CID 10335167
3-cyclohexyl-3-ethoxy-4,4,5,5,5-pentafluoropentan-2-ol (PubChem CID 10335167) has the molecular formula C13H21F5O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-cyclohexyl-3-ethoxy-4,4,5,5,5-pentafluoropentan-2-ol.
| Compound Name | 3-cyclohexyl-3-ethoxy-4,4,5,5,5-pentafluoropentan-2-ol |
|---|---|
| PubChem CID | 10335167 |
| Molecular Formula | C13H21F5O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-cyclohexyl-3-ethoxy-4,4,5,5,5-pentafluoropentan-2-ol |
| SMILES | CCOC(C(C)O)(C1CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H21F5O2/c1-3-20-11(9(2)19,10-7-5-4-6-8-10)12(14,15)13(16,17)18/h9-10,19H,3-8H2,1-2H3 |
| InChIKey | IZLAAAZLORLXSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|