C14H20ClN3O — CID 103352115
[2-(aminomethyl)-4-ethylpiperidin-1-yl]-(5-chloro-2-pyridinyl)methanone (PubChem CID 103352115) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is [2-(aminomethyl)-4-ethylpiperidin-1-yl]-(5-chloro-2-pyridinyl)methanone.
| Compound Name | [2-(aminomethyl)-4-ethylpiperidin-1-yl]-(5-chloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 103352115 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [2-(aminomethyl)-4-ethylpiperidin-1-yl]-(5-chloro-2-pyridinyl)methanone |
| SMILES | CCC1CCN(C(=O)c2ccc(Cl)cn2)C(CN)C1 |
| InChI | InChI=1S/C14H20ClN3O/c1-2-10-5-6-18(12(7-10)8-16)14(19)13-4-3-11(15)9-17-13/h3-4,9-10,12H,2,5-8,16H2,1H3 |
| InChIKey | MGNXGZIGXWQOFZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |