C18H26O4 — CID 10335313
(3aR,4R,5R,6aS)-4-[(3S)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 10335313) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3S)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3S)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 10335313 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3S)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | OC1C[C@@H]2[C@@H](CC[C@H](O)CCc3ccccc3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C18H26O4/c19-13(7-6-12-4-2-1-3-5-12)8-9-14-15-10-18(21)22-17(15)11-16(14)20/h1-5,13-21H,6-11H2/t13-,14-,15-,16-,17+,18?/m1/s1 |
| InChIKey | RDWZBWVDSHTXLT-XXFAHNLHSA-N |
| XLogP | 1.86 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |