C11H24N2O2 — CID 103353189
3-[2-(aminomethyl)-4-ethylpiperidin-1-yl]propane-1,2-diol (PubChem CID 103353189) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-4-ethylpiperidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[2-(aminomethyl)-4-ethylpiperidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 103353189 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-[2-(aminomethyl)-4-ethylpiperidin-1-yl]propane-1,2-diol |
| SMILES | CCC1CCN(CC(O)CO)C(CN)C1 |
| InChI | InChI=1S/C11H24N2O2/c1-2-9-3-4-13(7-11(15)8-14)10(5-9)6-12/h9-11,14-15H,2-8,12H2,1H3 |
| InChIKey | IXHOWVJYWYLUGY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |