About 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol
1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol (PubChem CID 10335639) has the molecular formula C20H25NO2
and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol |
| PubChem CID | 10335639 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N1CCC(O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25NO2/c1-16(19(22)17-8-4-2-5-9-17)21-14-12-20(23,13-15-21)18-10-6-3-7-11-18/h2-11,16,19,22-23H,12-15H2,1H3/t16-,19+/m0/s1 |
| InChIKey | RWLHDPSXYGPVBC-QFBILLFUSA-N |
| XLogP | 3.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol?
The IUPAC name of 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol (CID 10335639) is 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol.
What is the SMILES notation for 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol?
The canonical SMILES for 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol is C[C@@H]([C@@H](O)c1ccccc1)N1CCC(O)(c2ccccc2)CC1.
What is the InChIKey of 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol?
The InChIKey is RWLHDPSXYGPVBC-QFBILLFUSA-N. The full InChI is InChI=1S/C20H25NO2/c1-16(19(22)17-8-4-2-5-9-17)21-14-12-20(23,13-15-21)18-10-6-3-7-11-18/h2-11,16,19,22-23H,12-15H2,1H3/t16-,19+/m0/s1.
What are the key properties of 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol?
1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol has a molecular weight of 311.43 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-4-phenylpiperidin-4-ol is sourced from PubChem (CID 10335639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).