C21H31NO — CID 10335743
(2R,3R,4aR,8aR)-3-(4-phenylpiperidin-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol (PubChem CID 10335743) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is (2R,3R,4aR,8aR)-3-(4-phenylpiperidin-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
| Compound Name | (2R,3R,4aR,8aR)-3-(4-phenylpiperidin-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 10335743 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (2R,3R,4aR,8aR)-3-(4-phenylpiperidin-1-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol |
| SMILES | O[C@@H]1C[C@H]2CCCC[C@@H]2CC1N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H31NO/c23-21-15-19-9-5-4-8-18(19)14-20(21)22-12-10-17(11-13-22)16-6-2-1-3-7-16/h1-3,6-7,17-21,23H,4-5,8-15H2/t18-,19-,20?,21-/m1/s1 |
| InChIKey | KBAUXYUOKBLCFC-WLSJHPEUSA-N |
| XLogP | 4.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |