C12H14N4O — CID 103357731
1-(1,2,4-benzotriazin-3-yl)-3-methylpyrrolidin-3-ol (PubChem CID 103357731) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-(1,2,4-benzotriazin-3-yl)-3-methylpyrrolidin-3-ol.
| Compound Name | 1-(1,2,4-benzotriazin-3-yl)-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103357731 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(1,2,4-benzotriazin-3-yl)-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(c2nnc3ccccc3n2)C1 |
| InChI | InChI=1S/C12H14N4O/c1-12(17)6-7-16(8-12)11-13-9-4-2-3-5-10(9)14-15-11/h2-5,17H,6-8H2,1H3 |
| InChIKey | HCCUSDFHUMZRIU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |