C15H18N4O2 — CID 103358352
(4-hydrazinylquinolin-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone (PubChem CID 103358352) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is (4-hydrazinylquinolin-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone.
| Compound Name | (4-hydrazinylquinolin-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103358352 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (4-hydrazinylquinolin-2-yl)-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1(O)CCN(C(=O)c2cc(NN)c3ccccc3n2)C1 |
| InChI | InChI=1S/C15H18N4O2/c1-15(21)6-7-19(9-15)14(20)13-8-12(18-16)10-4-2-3-5-11(10)17-13/h2-5,8,21H,6-7,9,16H2,1H3,(H,17,18) |
| InChIKey | CQLKDOWKDMKQDG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|