C17H27FN2O — CID 103358486
1-[3-(ethylamino)-3-(3-fluoro-4-methylphenyl)propyl]-3-methylpyrrolidin-3-ol (PubChem CID 103358486) has the molecular formula C17H27FN2O and a molecular weight of 294.41 g/mol. Its IUPAC name is 1-[3-(ethylamino)-3-(3-fluoro-4-methylphenyl)propyl]-3-methylpyrrolidin-3-ol.
| Compound Name | 1-[3-(ethylamino)-3-(3-fluoro-4-methylphenyl)propyl]-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103358486 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[3-(ethylamino)-3-(3-fluoro-4-methylphenyl)propyl]-3-methylpyrrolidin-3-ol |
| SMILES | CCNC(CCN1CCC(C)(O)C1)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C17H27FN2O/c1-4-19-16(14-6-5-13(2)15(18)11-14)7-9-20-10-8-17(3,21)12-20/h5-6,11,16,19,21H,4,7-10,12H2,1-3H3 |
| InChIKey | QYYNOQRHWAAPJM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |