C9H13N5OS — CID 103359130
7-(3-amino-1,2-thiazol-5-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 103359130) has the molecular formula C9H13N5OS and a molecular weight of 239.30 g/mol. Its IUPAC name is 7-(3-amino-1,2-thiazol-5-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(3-amino-1,2-thiazol-5-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 103359130 |
| Molecular Formula | C9H13N5OS |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 7-(3-amino-1,2-thiazol-5-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Nc1cc(N2CCN3C(=O)NCC3C2)sn1 |
| InChI | InChI=1S/C9H13N5OS/c10-7-3-8(16-12-7)13-1-2-14-6(5-13)4-11-9(14)15/h3,6H,1-2,4-5H2,(H2,10,12)(H,11,15) |
| InChIKey | UKORPYUFCPYNFN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |