About 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine
5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine (PubChem CID 103360238) has the molecular formula C14H26N4OS
and a molecular weight of 298.46 g/mol. Its IUPAC name is 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine |
| PubChem CID | 103360238 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine |
| SMILES | CCN1CCC(CNc2snc(N)c2OC(C)C)CC1 |
| InChI | InChI=1S/C14H26N4OS/c1-4-18-7-5-11(6-8-18)9-16-14-12(19-10(2)3)13(15)17-20-14/h10-11,16H,4-9H2,1-3H3,(H2,15,17) |
| InChIKey | LJGDDUCNZRLHJF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine?
The IUPAC name of 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine (CID 103360238) is 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine?
The canonical SMILES for 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine is CCN1CCC(CNc2snc(N)c2OC(C)C)CC1.
What is the InChIKey of 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine?
The InChIKey is LJGDDUCNZRLHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4OS/c1-4-18-7-5-11(6-8-18)9-16-14-12(19-10(2)3)13(15)17-20-14/h10-11,16H,4-9H2,1-3H3,(H2,15,17).
What are the key properties of 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine?
5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine has a molecular weight of 298.46 g/mol, XLogP of 2.66, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[(1-ethylpiperidin-4-yl)methyl]-4-propan-2-yloxy-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103360238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).