About 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide
3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide (PubChem CID 103360319) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide |
| PubChem CID | 103360319 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1snc(N)c1C |
| InChI | InChI=1S/C10H18N4OS/c1-3-5-12-8(15)4-6-13-10-7(2)9(11)14-16-10/h13H,3-6H2,1-2H3,(H2,11,14)(H,12,15) |
| InChIKey | XVKHBQTUUXZGBL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide?
The IUPAC name of 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide (CID 103360319) is 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide.
What is the SMILES notation for 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide?
The canonical SMILES for 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide is CCCNC(=O)CCNc1snc(N)c1C.
What is the InChIKey of 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide?
The InChIKey is XVKHBQTUUXZGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-3-5-12-8(15)4-6-13-10-7(2)9(11)14-16-10/h13H,3-6H2,1-2H3,(H2,11,14)(H,12,15).
What are the key properties of 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide?
3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide has a molecular weight of 242.35 g/mol, XLogP of 1.36, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-4-methyl-1,2-thiazol-5-yl)amino]-N-propylpropanamide is sourced from PubChem (CID 103360319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).