About 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole
5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole (PubChem CID 10336114) has the molecular formula C10H9IO4
and a molecular weight of 320.08 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole |
| PubChem CID | 10336114 |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole |
| SMILES | Ic1cc2c(cc1C1OCCO1)OCO2 |
| InChI | InChI=1S/C10H9IO4/c11-7-4-9-8(14-5-15-9)3-6(7)10-12-1-2-13-10/h3-4,10H,1-2,5H2 |
| InChIKey | XJNRDWVSYBKPHU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole?
The IUPAC name of 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole (CID 10336114) is 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole.
What is the SMILES notation for 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole?
The canonical SMILES for 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole is Ic1cc2c(cc1C1OCCO1)OCO2.
What is the InChIKey of 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole?
The InChIKey is XJNRDWVSYBKPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IO4/c11-7-4-9-8(14-5-15-9)3-6(7)10-12-1-2-13-10/h3-4,10H,1-2,5H2.
What are the key properties of 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole?
5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole has a molecular weight of 320.08 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxolan-2-yl)-6-iodo-1,3-benzodioxole is sourced from PubChem (CID 10336114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).