C12H13F3N4OS — CID 103361715
4-pyridin-3-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2-thiazole-3,5-diamine (PubChem CID 103361715) has the molecular formula C12H13F3N4OS and a molecular weight of 318.32 g/mol. Its IUPAC name is 4-pyridin-3-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2-thiazole-3,5-diamine.
| Compound Name | 4-pyridin-3-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103361715 |
| Molecular Formula | C12H13F3N4OS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-pyridin-3-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCOCC(F)(F)F)c1-c1cccnc1 |
| InChI | InChI=1S/C12H13F3N4OS/c13-12(14,15)7-20-5-4-18-11-9(10(16)19-21-11)8-2-1-3-17-6-8/h1-3,6,18H,4-5,7H2,(H2,16,19) |
| InChIKey | PPJOWAQXJNRGSI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|