About 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide
3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide (PubChem CID 103362628) has the molecular formula C11H22N4O2S2
and a molecular weight of 306.46 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide |
| PubChem CID | 103362628 |
| Molecular Formula | C11H22N4O2S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide |
| SMILES | CCCCCN(C)c1snc(N)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H22N4O2S2/c1-5-6-7-8-15(4)11-9(10(12)13-18-11)19(16,17)14(2)3/h5-8H2,1-4H3,(H2,12,13) |
| InChIKey | LUHCJBMTOLHPLO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide?
The IUPAC name of 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide (CID 103362628) is 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide.
What is the SMILES notation for 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide?
The canonical SMILES for 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide is CCCCCN(C)c1snc(N)c1S(=O)(=O)N(C)C.
What is the InChIKey of 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide?
The InChIKey is LUHCJBMTOLHPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O2S2/c1-5-6-7-8-15(4)11-9(10(12)13-18-11)19(16,17)14(2)3/h5-8H2,1-4H3,(H2,12,13).
What are the key properties of 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide?
3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide has a molecular weight of 306.46 g/mol, XLogP of 1.60, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide is sourced from PubChem (CID 103362628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).