C11H22N4O2S2 — CID 103362628
3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide (PubChem CID 103362628) has the molecular formula C11H22N4O2S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide.
| Compound Name | 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 103362628 |
| Molecular Formula | C11H22N4O2S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-amino-N,N-dimethyl-5-[methyl(pentyl)amino]-1,2-thiazole-4-sulfonamide |
| SMILES | CCCCCN(C)c1snc(N)c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H22N4O2S2/c1-5-6-7-8-15(4)11-9(10(12)13-18-11)19(16,17)14(2)3/h5-8H2,1-4H3,(H2,12,13) |
| InChIKey | LUHCJBMTOLHPLO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|