C10H17N3S — CID 103363088
5-(3,3-dimethylpiperidin-1-yl)-1,2-thiazol-3-amine (PubChem CID 103363088) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 5-(3,3-dimethylpiperidin-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 5-(3,3-dimethylpiperidin-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103363088 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-(3,3-dimethylpiperidin-1-yl)-1,2-thiazol-3-amine |
| SMILES | CC1(C)CCCN(c2cc(N)ns2)C1 |
| InChI | InChI=1S/C10H17N3S/c1-10(2)4-3-5-13(7-10)9-6-8(11)12-14-9/h6H,3-5,7H2,1-2H3,(H2,11,12) |
| InChIKey | VZPJJTJYGCWWID-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |