About 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline
3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline (PubChem CID 10336427) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline |
| PubChem CID | 10336427 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline |
| SMILES | COc1ccc(-c2cnc3cc(OC)c(OC)cc3c2)cc1OC |
| InChI | InChI=1S/C19H19NO4/c1-21-16-6-5-12(8-17(16)22-2)14-7-13-9-18(23-3)19(24-4)10-15(13)20-11-14/h5-11H,1-4H3 |
| InChIKey | BWIYMDQJIKNCMK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline (CID 10336427) is 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline is COc1ccc(-c2cnc3cc(OC)c(OC)cc3c2)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline?
The InChIKey is BWIYMDQJIKNCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4/c1-21-16-6-5-12(8-17(16)22-2)14-7-13-9-18(23-3)19(24-4)10-15(13)20-11-14/h5-11H,1-4H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline?
3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline has a molecular weight of 325.36 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinoline is sourced from PubChem (CID 10336427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).