About 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine
4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine (PubChem CID 103364621) has the molecular formula C11H17N3O3S2
and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine |
| PubChem CID | 103364621 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1NC1CC2CCC1O2 |
| InChI | InChI=1S/C11H17N3O3S2/c1-2-19(15,16)9-10(12)14-18-11(9)13-7-5-6-3-4-8(7)17-6/h6-8,13H,2-5H2,1H3,(H2,12,14) |
| InChIKey | YVKOCEBNFGAKMX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine?
The IUPAC name of 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine (CID 103364621) is 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine?
The canonical SMILES for 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine is CCS(=O)(=O)c1c(N)nsc1NC1CC2CCC1O2.
What is the InChIKey of 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine?
The InChIKey is YVKOCEBNFGAKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3S2/c1-2-19(15,16)9-10(12)14-18-11(9)13-7-5-6-3-4-8(7)17-6/h6-8,13H,2-5H2,1H3,(H2,12,14).
What are the key properties of 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine?
4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine has a molecular weight of 303.41 g/mol, XLogP of 1.25, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfonyl-5-N-(7-oxabicyclo[2.2.1]heptan-2-yl)-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103364621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).