C10H16F3N3O2S2 — CID 103364954
4-propylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364954) has the molecular formula C10H16F3N3O2S2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 4-propylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-propylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364954 |
| Molecular Formula | C10H16F3N3O2S2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-propylsulfonyl-5-N-(4,4,4-trifluorobutyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCCS(=O)(=O)c1c(N)nsc1NCCCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O2S2/c1-2-6-20(17,18)7-8(14)16-19-9(7)15-5-3-4-10(11,12)13/h15H,2-6H2,1H3,(H2,14,16) |
| InChIKey | ONICOZMTECJFPP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|