C10H16F3N3OS — CID 103364976
4-ethoxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364976) has the molecular formula C10H16F3N3OS and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-ethoxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethoxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364976 |
| Molecular Formula | C10H16F3N3OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-ethoxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCOc1c(N)nsc1NCCCCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3OS/c1-2-17-7-8(14)16-18-9(7)15-6-4-3-5-10(11,12)13/h15H,2-6H2,1H3,(H2,14,16) |
| InChIKey | MTKKNEFIHVGLNZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|