C11H18F3N3OS — CID 103364978
4-propan-2-yloxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364978) has the molecular formula C11H18F3N3OS and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-propan-2-yloxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-propan-2-yloxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364978 |
| Molecular Formula | C11H18F3N3OS |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-propan-2-yloxy-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine |
| SMILES | CC(C)Oc1c(N)nsc1NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3OS/c1-7(2)18-8-9(15)17-19-10(8)16-6-4-3-5-11(12,13)14/h7,16H,3-6H2,1-2H3,(H2,15,17) |
| InChIKey | KFCAGEOAIQYLGZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|