C11H18F3N3O2S2 — CID 103364980
4-propylsulfonyl-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine (PubChem CID 103364980) has the molecular formula C11H18F3N3O2S2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-propylsulfonyl-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-propylsulfonyl-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103364980 |
| Molecular Formula | C11H18F3N3O2S2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-propylsulfonyl-5-N-(5,5,5-trifluoropentyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCCS(=O)(=O)c1c(N)nsc1NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O2S2/c1-2-7-21(18,19)8-9(15)17-20-10(8)16-6-4-3-5-11(12,13)14/h16H,2-7H2,1H3,(H2,15,17) |
| InChIKey | QNMJZKWWWNYRSF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|