About 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide
2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide (PubChem CID 103365089) has the molecular formula C12H22N4O2S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide.
Molecular Properties
| Compound Name | 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide |
| PubChem CID | 103365089 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide |
| SMILES | CCOc1c(N)nsc1NC(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H22N4O2S/c1-6-18-8-9(13)16-19-11(8)14-7(2)10(17)15-12(3,4)5/h7,14H,6H2,1-5H3,(H2,13,16)(H,15,17) |
| InChIKey | MAHAMKSTLCQVBK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide?
The IUPAC name of 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide (CID 103365089) is 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide.
What is the SMILES notation for 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide?
The canonical SMILES for 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide is CCOc1c(N)nsc1NC(C)C(=O)NC(C)(C)C.
What is the InChIKey of 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide?
The InChIKey is MAHAMKSTLCQVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2S/c1-6-18-8-9(13)16-19-11(8)14-7(2)10(17)15-12(3,4)5/h7,14H,6H2,1-5H3,(H2,13,16)(H,15,17).
What are the key properties of 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide?
2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide has a molecular weight of 286.40 g/mol, XLogP of 1.84, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]-N-tert-butylpropanamide is sourced from PubChem (CID 103365089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).