C16H30N4O3 — CID 10336515
(1S,2S,3S,4R)-4-(diaminomethylideneamino)-3-[2-ethyl-1-(prop-1-en-2-ylamino)butyl]-2-hydroxycyclopentane-1-carboxylic acid (PubChem CID 10336515) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (1S,2S,3S,4R)-4-(diaminomethylideneamino)-3-[2-ethyl-1-(prop-1-en-2-ylamino)butyl]-2-hydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-4-(diaminomethylideneamino)-3-[2-ethyl-1-(prop-1-en-2-ylamino)butyl]-2-hydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 10336515 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (1S,2S,3S,4R)-4-(diaminomethylideneamino)-3-[2-ethyl-1-(prop-1-en-2-ylamino)butyl]-2-hydroxycyclopentane-1-carboxylic acid |
| SMILES | C=C(C)NC(C(CC)CC)[C@@H]1[C@H](O)[C@@H](C(=O)O)C[C@H]1N=C(N)N |
| InChI | InChI=1S/C16H30N4O3/c1-5-9(6-2)13(19-8(3)4)12-11(20-16(17)18)7-10(14(12)21)15(22)23/h9-14,19,21H,3,5-7H2,1-2,4H3,(H,22,23)(H4,17,18,20)/t10-,11+,12+,13?,14+/m0/s1 |
| InChIKey | USDLLJQVNCUMKA-PHEXNXERSA-N |
| XLogP | 0.64 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|