C18H34O3Si — CID 10336527
(4S,4aS,7S,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 10336527) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (4S,4aS,7S,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | (4S,4aS,7S,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 10336527 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (4S,4aS,7S,8S,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | C[C@@H]1[C@@H](O)CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)[C@@H]12 |
| InChI | InChI=1S/C18H34O3Si/c1-12-13(19)10-11-18(5)15(9-8-14(20)16(12)18)21-22(6,7)17(2,3)4/h12-13,15-16,19H,8-11H2,1-7H3/t12-,13+,15+,16-,18-/m1/s1 |
| InChIKey | VVDYIPRPYOOFJK-JAPAREKCSA-N |
| XLogP | 4.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|