About 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine
4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine (PubChem CID 103365325) has the molecular formula C14H18N4S2
and a molecular weight of 306.46 g/mol. Its IUPAC name is 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine |
| PubChem CID | 103365325 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine |
| SMILES | Nc1nsc(NCC2CCSCC2)c1-c1cccnc1 |
| InChI | InChI=1S/C14H18N4S2/c15-13-12(11-2-1-5-16-9-11)14(20-18-13)17-8-10-3-6-19-7-4-10/h1-2,5,9-10,17H,3-4,6-8H2,(H2,15,18) |
| InChIKey | PXTWPXQIDZHPPK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine?
The IUPAC name of 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine (CID 103365325) is 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine?
The canonical SMILES for 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine is Nc1nsc(NCC2CCSCC2)c1-c1cccnc1.
What is the InChIKey of 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine?
The InChIKey is PXTWPXQIDZHPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4S2/c15-13-12(11-2-1-5-16-9-11)14(20-18-13)17-8-10-3-6-19-7-4-10/h1-2,5,9-10,17H,3-4,6-8H2,(H2,15,18).
What are the key properties of 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine?
4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine has a molecular weight of 306.46 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-yl-5-N-(thian-4-ylmethyl)-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103365325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).