C9H15N3S — CID 103365807
5-(2,4-dimethylpyrrolidin-1-yl)-1,2-thiazol-3-amine (PubChem CID 103365807) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-(2,4-dimethylpyrrolidin-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 5-(2,4-dimethylpyrrolidin-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103365807 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-(2,4-dimethylpyrrolidin-1-yl)-1,2-thiazol-3-amine |
| SMILES | CC1CC(C)N(c2cc(N)ns2)C1 |
| InChI | InChI=1S/C9H15N3S/c1-6-3-7(2)12(5-6)9-4-8(10)11-13-9/h4,6-7H,3,5H2,1-2H3,(H2,10,11) |
| InChIKey | QLHAOXIYTJTQFR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |