About 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide
3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide (PubChem CID 103366052) has the molecular formula C10H18N4O3S2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide |
| PubChem CID | 103366052 |
| Molecular Formula | C10H18N4O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(N)nsc1N1CCC(C)(O)C1 |
| InChI | InChI=1S/C10H18N4O3S2/c1-10(15)4-5-14(6-10)9-7(8(11)12-18-9)19(16,17)13(2)3/h15H,4-6H2,1-3H3,(H2,11,12) |
| InChIKey | WGNMELKRZIOTEG-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide?
The IUPAC name of 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide (CID 103366052) is 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide.
What is the SMILES notation for 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide?
The canonical SMILES for 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide is CN(C)S(=O)(=O)c1c(N)nsc1N1CCC(C)(O)C1.
What is the InChIKey of 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide?
The InChIKey is WGNMELKRZIOTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O3S2/c1-10(15)4-5-14(6-10)9-7(8(11)12-18-9)19(16,17)13(2)3/h15H,4-6H2,1-3H3,(H2,11,12).
What are the key properties of 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide?
3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide has a molecular weight of 306.41 g/mol, XLogP of -0.06, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(3-hydroxy-3-methylpyrrolidin-1-yl)-N,N-dimethyl-1,2-thiazole-4-sulfonamide is sourced from PubChem (CID 103366052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).