C12H21F3N2O — CID 103366269
2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 103366269) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103366269 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylmethyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | NCC(CN1CCOC2CCCCC21)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O/c13-12(14,15)9(7-16)8-17-5-6-18-11-4-2-1-3-10(11)17/h9-11H,1-8,16H2 |
| InChIKey | UFOCLFJKOCRBAM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |