C11H19F3N2O — CID 103366448
2-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol (PubChem CID 103366448) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol.
| Compound Name | 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 103366448 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
| SMILES | NCC(CN1CC2CCC(O)C2C1)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c12-11(13,14)8(3-15)5-16-4-7-1-2-10(17)9(7)6-16/h7-10,17H,1-6,15H2 |
| InChIKey | OBPLKADWSCEEHC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |