About 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol
4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol (PubChem CID 103366461) has the molecular formula C9H19F3N2O
and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol.
Molecular Properties
| Compound Name | 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol |
| PubChem CID | 103366461 |
| Molecular Formula | C9H19F3N2O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol |
| SMILES | CC(O)CCN(C)CC(CN)C(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O/c1-7(15)3-4-14(2)6-8(5-13)9(10,11)12/h7-8,15H,3-6,13H2,1-2H3 |
| InChIKey | HSHHYUVLDMHWOY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol?
The IUPAC name of 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol (CID 103366461) is 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol.
What is the SMILES notation for 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol?
The canonical SMILES for 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol is CC(O)CCN(C)CC(CN)C(F)(F)F.
What is the InChIKey of 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol?
The InChIKey is HSHHYUVLDMHWOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N2O/c1-7(15)3-4-14(2)6-8(5-13)9(10,11)12/h7-8,15H,3-6,13H2,1-2H3.
What are the key properties of 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol?
4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol has a molecular weight of 228.26 g/mol, XLogP of 0.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(aminomethyl)-3,3,3-trifluoropropyl]-methylamino]butan-2-ol is sourced from PubChem (CID 103366461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).