About [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol
[4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol (PubChem CID 103366491) has the molecular formula C10H19F3N2O2
and a molecular weight of 256.27 g/mol. Its IUPAC name is [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol |
| PubChem CID | 103366491 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol |
| SMILES | CC1CN(CC(CN)C(F)(F)F)CC(CO)O1 |
| InChI | InChI=1S/C10H19F3N2O2/c1-7-3-15(5-9(6-16)17-7)4-8(2-14)10(11,12)13/h7-9,16H,2-6,14H2,1H3 |
| InChIKey | DNKRJIGYOYSHCX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol?
The IUPAC name of [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol (CID 103366491) is [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol.
What is the SMILES notation for [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol?
The canonical SMILES for [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol is CC1CN(CC(CN)C(F)(F)F)CC(CO)O1.
What is the InChIKey of [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol?
The InChIKey is DNKRJIGYOYSHCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O2/c1-7-3-15(5-9(6-16)17-7)4-8(2-14)10(11,12)13/h7-9,16H,2-6,14H2,1H3.
What are the key properties of [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol?
[4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol has a molecular weight of 256.27 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(aminomethyl)-3,3,3-trifluoropropyl]-6-methylmorpholin-2-yl]methanol is sourced from PubChem (CID 103366491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).