C13H15F3N2O — CID 103366538
3,3,3-trifluoro-2-[(5-methoxyindol-1-yl)methyl]propan-1-amine (PubChem CID 103366538) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(5-methoxyindol-1-yl)methyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-2-[(5-methoxyindol-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103366538 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[(5-methoxyindol-1-yl)methyl]propan-1-amine |
| SMILES | COc1ccc2c(ccn2CC(CN)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O/c1-19-11-2-3-12-9(6-11)4-5-18(12)8-10(7-17)13(14,15)16/h2-6,10H,7-8,17H2,1H3 |
| InChIKey | IOEMFZGHXQEABF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |