About 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide
3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide (PubChem CID 103367518) has the molecular formula C10H16F3N3O
and a molecular weight of 251.25 g/mol. Its IUPAC name is 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide |
| PubChem CID | 103367518 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNCC(C#N)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O/c1-7(2)16-9(17)3-4-15-6-8(5-14)10(11,12)13/h7-8,15H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | SXJHVTUENBNUEU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide?
The IUPAC name of 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide (CID 103367518) is 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide.
What is the SMILES notation for 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide?
The canonical SMILES for 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide is CC(C)NC(=O)CCNCC(C#N)C(F)(F)F.
What is the InChIKey of 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide?
The InChIKey is SXJHVTUENBNUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3O/c1-7(2)16-9(17)3-4-15-6-8(5-14)10(11,12)13/h7-8,15H,3-4,6H2,1-2H3,(H,16,17).
What are the key properties of 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide?
3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide has a molecular weight of 251.25 g/mol, XLogP of 1.19, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-cyano-3,3,3-trifluoropropyl)amino]-N-propan-2-ylpropanamide is sourced from PubChem (CID 103367518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).