C20H26O2S — CID 10336778
(E)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 10336778) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is (E)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 10336778 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (E)-1-[(2R,4aR,7R,8aR)-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiin-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](C(=O)/C=C/c1ccccc1)SC2(C)C |
| InChI | InChI=1S/C20H26O2S/c1-14-9-11-16-18(13-14)22-19(23-20(16,2)3)17(21)12-10-15-7-5-4-6-8-15/h4-8,10,12,14,16,18-19H,9,11,13H2,1-3H3/b12-10+/t14-,16-,18-,19-/m1/s1 |
| InChIKey | BFIMVOZTTYFJSU-HGJLXKJRSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|