C8H7F3N2O3 — CID 103368111
2-[(3,5-dioxomorpholin-4-yl)methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103368111) has the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. Its IUPAC name is 2-[(3,5-dioxomorpholin-4-yl)methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[(3,5-dioxomorpholin-4-yl)methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103368111 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-[(3,5-dioxomorpholin-4-yl)methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | N#CC(CN1C(=O)COCC1=O)C(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O3/c9-8(10,11)5(1-12)2-13-6(14)3-16-4-7(13)15/h5H,2-4H2 |
| InChIKey | ARYUNHMZJLRMKG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|