C13H17F3N4S — CID 103368489
3,3,3-trifluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]propanethioamide (PubChem CID 103368489) has the molecular formula C13H17F3N4S and a molecular weight of 318.37 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103368489 |
| Molecular Formula | C13H17F3N4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[(4-pyridin-2-ylpiperazin-1-yl)methyl]propanethioamide |
| SMILES | NC(=S)C(CN1CCN(c2ccccn2)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H17F3N4S/c14-13(15,16)10(12(17)21)9-19-5-7-20(8-6-19)11-3-1-2-4-18-11/h1-4,10H,5-9H2,(H2,17,21) |
| InChIKey | XJJOBMNPVNKQKT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|