C9H15F3N2S2 — CID 103368585
3,3,3-trifluoro-2-(1,4-thiazepan-4-ylmethyl)propanethioamide (PubChem CID 103368585) has the molecular formula C9H15F3N2S2 and a molecular weight of 272.36 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(1,4-thiazepan-4-ylmethyl)propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-(1,4-thiazepan-4-ylmethyl)propanethioamide |
|---|---|
| PubChem CID | 103368585 |
| Molecular Formula | C9H15F3N2S2 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3,3,3-trifluoro-2-(1,4-thiazepan-4-ylmethyl)propanethioamide |
| SMILES | NC(=S)C(CN1CCCSCC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2S2/c10-9(11,12)7(8(13)15)6-14-2-1-4-16-5-3-14/h7H,1-6H2,(H2,13,15) |
| InChIKey | DGMURULNNWXIBJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|