C8H13F3N2OS2 — CID 103368619
3,3,3-trifluoro-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]propanethioamide (PubChem CID 103368619) has the molecular formula C8H13F3N2OS2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103368619 |
| Molecular Formula | C8H13F3N2OS2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 3,3,3-trifluoro-2-[(1-oxo-1,4-thiazinan-4-yl)methyl]propanethioamide |
| SMILES | NC(=S)C(CN1CCS(=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2OS2/c9-8(10,11)6(7(12)15)5-13-1-3-16(14)4-2-13/h6H,1-5H2,(H2,12,15) |
| InChIKey | AZJDCIOSNMQKQM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|