C12H22F3N3S — CID 103368690
2-[(4-butan-2-ylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368690) has the molecular formula C12H22F3N3S and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-[(4-butan-2-ylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(4-butan-2-ylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368690 |
| Molecular Formula | C12H22F3N3S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(4-butan-2-ylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CCC(C)N1CCN(CC(C(N)=S)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3S/c1-3-9(2)18-6-4-17(5-7-18)8-10(11(16)19)12(13,14)15/h9-10H,3-8H2,1-2H3,(H2,16,19) |
| InChIKey | YXXVUMCZMBCQOW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|