C11H17F3N2OS — CID 103368734
3,3,3-trifluoro-2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]propanethioamide (PubChem CID 103368734) has the molecular formula C11H17F3N2OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103368734 |
| Molecular Formula | C11H17F3N2OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]propanethioamide |
| SMILES | NC(=S)C(CN1C2CCC1CC(O)C2)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2OS/c12-11(13,14)9(10(15)18)5-16-6-1-2-7(16)4-8(17)3-6/h6-9,17H,1-5H2,(H2,15,18) |
| InChIKey | WWPJRFUPZKTRGX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|