C10H19F3N2OS — CID 103368794
3,3,3-trifluoro-2-[[methyl(2-propan-2-yloxyethyl)amino]methyl]propanethioamide (PubChem CID 103368794) has the molecular formula C10H19F3N2OS and a molecular weight of 272.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[methyl(2-propan-2-yloxyethyl)amino]methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[[methyl(2-propan-2-yloxyethyl)amino]methyl]propanethioamide |
|---|---|
| PubChem CID | 103368794 |
| Molecular Formula | C10H19F3N2OS |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3,3,3-trifluoro-2-[[methyl(2-propan-2-yloxyethyl)amino]methyl]propanethioamide |
| SMILES | CC(C)OCCN(C)CC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2OS/c1-7(2)16-5-4-15(3)6-8(9(14)17)10(11,12)13/h7-8H,4-6H2,1-3H3,(H2,14,17) |
| InChIKey | SMKOTIRGUFUARR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|