C12H20F3N3O2S — CID 103368813
4-(2-carbamothioyl-3,3,3-trifluoropropyl)-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 103368813) has the molecular formula C12H20F3N3O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 4-(2-carbamothioyl-3,3,3-trifluoropropyl)-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-(2-carbamothioyl-3,3,3-trifluoropropyl)-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 103368813 |
| Molecular Formula | C12H20F3N3O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-(2-carbamothioyl-3,3,3-trifluoropropyl)-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1COCCN1CC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C12H20F3N3O2S/c1-7(2)17-11(19)9-6-20-4-3-18(9)5-8(10(16)21)12(13,14)15/h7-9H,3-6H2,1-2H3,(H2,16,21)(H,17,19) |
| InChIKey | CMRQODIQVVJKHB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|