C11H18F3N3OS — CID 103368820
N-[1-(2-carbamothioyl-3,3,3-trifluoropropyl)piperidin-4-yl]acetamide (PubChem CID 103368820) has the molecular formula C11H18F3N3OS and a molecular weight of 297.35 g/mol. Its IUPAC name is N-[1-(2-carbamothioyl-3,3,3-trifluoropropyl)piperidin-4-yl]acetamide.
| Compound Name | N-[1-(2-carbamothioyl-3,3,3-trifluoropropyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 103368820 |
| Molecular Formula | C11H18F3N3OS |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[1-(2-carbamothioyl-3,3,3-trifluoropropyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(CC(C(N)=S)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3N3OS/c1-7(18)16-8-2-4-17(5-3-8)6-9(10(15)19)11(12,13)14/h8-9H,2-6H2,1H3,(H2,15,19)(H,16,18) |
| InChIKey | FLHQEGROGRTOCY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|