C10H17F3N2S2 — CID 103368833
2-[(2,2-dimethylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368833) has the molecular formula C10H17F3N2S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-[(2,2-dimethylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(2,2-dimethylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368833 |
| Molecular Formula | C10H17F3N2S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[(2,2-dimethylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CC1(C)CN(CC(C(N)=S)C(F)(F)F)CCS1 |
| InChI | InChI=1S/C10H17F3N2S2/c1-9(2)6-15(3-4-17-9)5-7(8(14)16)10(11,12)13/h7H,3-6H2,1-2H3,(H2,14,16) |
| InChIKey | VADSWWAFHSXDNU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|