C11H19F3N2O2S — CID 103368840
3,3,3-trifluoro-2-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]propanethioamide (PubChem CID 103368840) has the molecular formula C11H19F3N2O2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]propanethioamide |
|---|---|
| PubChem CID | 103368840 |
| Molecular Formula | C11H19F3N2O2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]propanethioamide |
| SMILES | CC1(C)CN(CC(C(N)=S)C(F)(F)F)CC(CO)O1 |
| InChI | InChI=1S/C11H19F3N2O2S/c1-10(2)6-16(3-7(5-17)18-10)4-8(9(15)19)11(12,13)14/h7-8,17H,3-6H2,1-2H3,(H2,15,19) |
| InChIKey | KBDKDFVTJXXYSV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|