C10H17F3N2O2S — CID 103368853
3,3,3-trifluoro-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]propanethioamide (PubChem CID 103368853) has the molecular formula C10H17F3N2O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]propanethioamide |
|---|---|
| PubChem CID | 103368853 |
| Molecular Formula | C10H17F3N2O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]propanethioamide |
| SMILES | CC1CN(CC(C(N)=S)C(F)(F)F)CC(CO)O1 |
| InChI | InChI=1S/C10H17F3N2O2S/c1-6-2-15(3-7(5-16)17-6)4-8(9(14)18)10(11,12)13/h6-8,16H,2-5H2,1H3,(H2,14,18) |
| InChIKey | OTLYJQITMDRGMY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|